C17H14O8 — CID 71505385
(2,3-diacetyloxy-4-hydroxy-5-oxobenzo[7]annulen-6-yl) acetate (PubChem CID 71505385) has the molecular formula C17H14O8 and a molecular weight of 346.29 g/mol. Its IUPAC name is (2,3-diacetyloxy-4-hydroxy-5-oxobenzo[7]annulen-6-yl) acetate.
| Compound Name | (2,3-diacetyloxy-4-hydroxy-5-oxobenzo[7]annulen-6-yl) acetate |
|---|---|
| PubChem CID | 71505385 |
| Molecular Formula | C17H14O8 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | (2,3-diacetyloxy-4-hydroxy-5-oxobenzo[7]annulen-6-yl) acetate |
| SMILES | CC(=O)Oc1cc2cccc(OC(C)=O)c(=O)c2c(O)c1OC(C)=O |
| InChI | InChI=1S/C17H14O8/c1-8(18)23-12-6-4-5-11-7-13(24-9(2)19)17(25-10(3)20)16(22)14(11)15(12)21/h4-7,22H,1-3H3 |
| InChIKey | HJIVTYBHKLKJSH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|