C14H22O6S — CID 71505617
methyl (1S,2S,6R,7R,10S)-4,4,12,12-tetramethyl-3,5,11,13-tetraoxa-8-thiatricyclo[8.3.0.02,6]tridecane-7-carboxylate (PubChem CID 71505617) has the molecular formula C14H22O6S and a molecular weight of 318.39 g/mol. Its IUPAC name is methyl (1S,2S,6R,7R,10S)-4,4,12,12-tetramethyl-3,5,11,13-tetraoxa-8-thiatricyclo[8.3.0.02,6]tridecane-7-carboxylate.
| Compound Name | methyl (1S,2S,6R,7R,10S)-4,4,12,12-tetramethyl-3,5,11,13-tetraoxa-8-thiatricyclo[8.3.0.02,6]tridecane-7-carboxylate |
|---|---|
| PubChem CID | 71505617 |
| Molecular Formula | C14H22O6S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | methyl (1S,2S,6R,7R,10S)-4,4,12,12-tetramethyl-3,5,11,13-tetraoxa-8-thiatricyclo[8.3.0.02,6]tridecane-7-carboxylate |
| SMILES | COC(=O)[C@@H]1SC[C@H]2OC(C)(C)O[C@H]2[C@@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C14H22O6S/c1-13(2)17-7-6-21-11(12(15)16-5)10-9(8(7)18-13)19-14(3,4)20-10/h7-11H,6H2,1-5H3/t7-,8-,9+,10-,11-/m1/s1 |
| InChIKey | PCCQRMNCQJBBIF-KAMPLNKDSA-N |
| XLogP | 1.32 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |