C15H24O6S — CID 23250115
ethyl 2-[(3aR,4R,6R,6aS)-4-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-6-yl]acetate (PubChem CID 23250115) has the molecular formula C15H24O6S and a molecular weight of 332.42 g/mol. Its IUPAC name is ethyl 2-[(3aR,4R,6R,6aS)-4-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-6-yl]acetate.
| Compound Name | ethyl 2-[(3aR,4R,6R,6aS)-4-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 23250115 |
| Molecular Formula | C15H24O6S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | ethyl 2-[(3aR,4R,6R,6aS)-4-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-6-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1S[C@H](CC(=O)OCC)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C15H24O6S/c1-5-18-11(16)7-9-13-14(21-15(3,4)20-13)10(22-9)8-12(17)19-6-2/h9-10,13-14H,5-8H2,1-4H3/t9-,10-,13-,14+/m1/s1 |
| InChIKey | FTCJUXAMRPLQDG-MHWZDGSBSA-N |
| XLogP | 1.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |