C13H22O4S — CID 11747763
methyl 5-[(3aR,4S,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoate (PubChem CID 11747763) has the molecular formula C13H22O4S and a molecular weight of 274.38 g/mol. Its IUPAC name is methyl 5-[(3aR,4S,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoate.
| Compound Name | methyl 5-[(3aR,4S,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoate |
|---|---|
| PubChem CID | 11747763 |
| Molecular Formula | C13H22O4S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | methyl 5-[(3aR,4S,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoate |
| SMILES | COC(=O)CCCC[C@@H]1SC[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C13H22O4S/c1-13(2)16-9-8-18-10(12(9)17-13)6-4-5-7-11(14)15-3/h9-10,12H,4-8H2,1-3H3/t9-,10+,12-/m1/s1 |
| InChIKey | XKGLHYCHQGHHCQ-JFGNBEQYSA-N |
| XLogP | 2.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|