C10H14O6S — CID 121337624
5-[(3aS,4S)-2,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoic acid (PubChem CID 121337624) has the molecular formula C10H14O6S and a molecular weight of 262.28 g/mol. Its IUPAC name is 5-[(3aS,4S)-2,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoic acid.
| Compound Name | 5-[(3aS,4S)-2,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 121337624 |
| Molecular Formula | C10H14O6S |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 5-[(3aS,4S)-2,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl]pentanoic acid |
| SMILES | O=C(O)CCCC[C@H]1[C@H]2OC(=O)OC2CS1=O |
| InChI | InChI=1S/C10H14O6S/c11-8(12)4-2-1-3-7-9-6(5-17(7)14)15-10(13)16-9/h6-7,9H,1-5H2,(H,11,12)/t6?,7-,9-,17?/m0/s1 |
| InChIKey | QCJYHKDFQRXJLL-YRPAIHIZSA-N |
| XLogP | 0.67 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|