About disodium;henicosanedioic acid;hydride
disodium;henicosanedioic acid;hydride (PubChem CID 174862400) has the molecular formula C21H42Na2O4
and a molecular weight of 404.54 g/mol. Its IUPAC name is disodium;henicosanedioic acid;hydride.
Molecular Properties
| Compound Name | disodium;henicosanedioic acid;hydride |
| PubChem CID | 174862400 |
| Molecular Formula | C21H42Na2O4 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | disodium;henicosanedioic acid;hydride |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCCCCC(=O)O.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C21H40O4.2Na.2H/c22-20(23)18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19-21(24)25;;;;/h1-19H2,(H,22,23)(H,24,25);;;;/q;2*+1;2*-1 |
| InChIKey | LWVRWQKLTYFJBF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze disodium;henicosanedioic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;henicosanedioic acid;hydride?
The IUPAC name of disodium;henicosanedioic acid;hydride (CID 174862400) is disodium;henicosanedioic acid;hydride.
What is the SMILES notation for disodium;henicosanedioic acid;hydride?
The canonical SMILES for disodium;henicosanedioic acid;hydride is O=C(O)CCCCCCCCCCCCCCCCCCCC(=O)O.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;henicosanedioic acid;hydride?
The InChIKey is LWVRWQKLTYFJBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O4.2Na.2H/c22-20(23)18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19-21(24)25;;;;/h1-19H2,(H,22,23)(H,24,25);;;;/q;2*+1;2*-1.
What are the key properties of disodium;henicosanedioic acid;hydride?
disodium;henicosanedioic acid;hydride has a molecular weight of 404.54 g/mol, XLogP of 0.80, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;henicosanedioic acid;hydride is sourced from PubChem (CID 174862400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).