About disodium;hydride;tetradecanedioic acid
disodium;hydride;tetradecanedioic acid (PubChem CID 175393935) has the molecular formula C14H28Na2O4
and a molecular weight of 306.35 g/mol. Its IUPAC name is disodium;hydride;tetradecanedioic acid.
Molecular Properties
| Compound Name | disodium;hydride;tetradecanedioic acid |
| PubChem CID | 175393935 |
| Molecular Formula | C14H28Na2O4 |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | disodium;hydride;tetradecanedioic acid |
| SMILES | O=C(O)CCCCCCCCCCCCC(=O)O.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C14H26O4.2Na.2H/c15-13(16)11-9-7-5-3-1-2-4-6-8-10-12-14(17)18;;;;/h1-12H2,(H,15,16)(H,17,18);;;;/q;2*+1;2*-1 |
| InChIKey | HUMQPYNYWFDBQV-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze disodium;hydride;tetradecanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;hydride;tetradecanedioic acid?
The IUPAC name of disodium;hydride;tetradecanedioic acid (CID 175393935) is disodium;hydride;tetradecanedioic acid.
What is the SMILES notation for disodium;hydride;tetradecanedioic acid?
The canonical SMILES for disodium;hydride;tetradecanedioic acid is O=C(O)CCCCCCCCCCCCC(=O)O.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;hydride;tetradecanedioic acid?
The InChIKey is HUMQPYNYWFDBQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4.2Na.2H/c15-13(16)11-9-7-5-3-1-2-4-6-8-10-12-14(17)18;;;;/h1-12H2,(H,15,16)(H,17,18);;;;/q;2*+1;2*-1.
What are the key properties of disodium;hydride;tetradecanedioic acid?
disodium;hydride;tetradecanedioic acid has a molecular weight of 306.35 g/mol, XLogP of -1.93, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;hydride;tetradecanedioic acid is sourced from PubChem (CID 175393935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).