C9H14O5S2 — CID 78321503
5-[(3aS,4S,6aR)-2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3,2]dioxathiol-4-yl]pentanoic acid (PubChem CID 78321503) has the molecular formula C9H14O5S2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3,2]dioxathiol-4-yl]pentanoic acid.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3,2]dioxathiol-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 78321503 |
| Molecular Formula | C9H14O5S2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3,2]dioxathiol-4-yl]pentanoic acid |
| SMILES | O=C(O)CCCC[C@@H]1SC[C@@H]2OS(=O)O[C@@H]21 |
| InChI | InChI=1S/C9H14O5S2/c10-8(11)4-2-1-3-7-9-6(5-15-7)13-16(12)14-9/h6-7,9H,1-5H2,(H,10,11)/t6-,7-,9-,16?/m0/s1 |
| InChIKey | ZYAQFLVDXFIRTO-OBHSILEVSA-N |
| XLogP | 1.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|