C8H14O2S3 — CID 131698885
5-(1,3,5-trithian-2-yl)pentanoic acid (PubChem CID 131698885) has the molecular formula C8H14O2S3 and a molecular weight of 238.40 g/mol. Its IUPAC name is 5-(1,3,5-trithian-2-yl)pentanoic acid.
| Compound Name | 5-(1,3,5-trithian-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 131698885 |
| Molecular Formula | C8H14O2S3 |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 5-(1,3,5-trithian-2-yl)pentanoic acid |
| SMILES | O=C(O)CCCCC1SCSCS1 |
| InChI | InChI=1S/C8H14O2S3/c9-7(10)3-1-2-4-8-12-5-11-6-13-8/h8H,1-6H2,(H,9,10) |
| InChIKey | LSUUGYCUXXVNNO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|