C9H18N2O2S — CID 10104842
5-[(2S,3S,4R)-3-amino-4-(15N)azanylthiolan-2-yl]pentanoic acid (PubChem CID 10104842) has the molecular formula C9H18N2O2S and a molecular weight of 219.32 g/mol. Its IUPAC name is 5-[(2S,3S,4R)-3-amino-4-(15N)azanylthiolan-2-yl]pentanoic acid.
| Compound Name | 5-[(2S,3S,4R)-3-amino-4-(15N)azanylthiolan-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 10104842 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 5-[(2S,3S,4R)-3-amino-4-(15N)azanylthiolan-2-yl]pentanoic acid |
| SMILES | N[C@@H]1[C@H](CCCCC(=O)O)SC[C@@H]1[15NH2] |
| InChI | InChI=1S/C9H18N2O2S/c10-6-5-14-7(9(6)11)3-1-2-4-8(12)13/h6-7,9H,1-5,10-11H2,(H,12,13)/t6-,7-,9-/m0/s1/i10+1 |
| InChIKey | JKNCSZDPWAVQAI-KZUASDKNSA-N |
| XLogP | 0.40 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|