C11H21NO3 — CID 57307550
5-[(2S,3S)-2-amino-3-hydroxycyclohexyl]pentanoic acid (PubChem CID 57307550) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 5-[(2S,3S)-2-amino-3-hydroxycyclohexyl]pentanoic acid.
| Compound Name | 5-[(2S,3S)-2-amino-3-hydroxycyclohexyl]pentanoic acid |
|---|---|
| PubChem CID | 57307550 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 5-[(2S,3S)-2-amino-3-hydroxycyclohexyl]pentanoic acid |
| SMILES | N[C@H]1C(CCCCC(=O)O)CCC[C@@H]1O |
| InChI | InChI=1S/C11H21NO3/c12-11-8(5-3-6-9(11)13)4-1-2-7-10(14)15/h8-9,11,13H,1-7,12H2,(H,14,15)/t8?,9-,11-/m0/s1 |
| InChIKey | FOCHIPAVKLTFNQ-PCFYAGROSA-N |
| XLogP | 1.12 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|