C22H42O2 — CID 18594595
7-[(1S,2R)-2-(4,4-dimethyloctyl)cyclopentyl]heptanoic acid (PubChem CID 18594595) has the molecular formula C22H42O2 and a molecular weight of 338.58 g/mol. Its IUPAC name is 7-[(1S,2R)-2-(4,4-dimethyloctyl)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,2R)-2-(4,4-dimethyloctyl)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 18594595 |
| Molecular Formula | C22H42O2 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.32 |
| IUPAC Name | 7-[(1S,2R)-2-(4,4-dimethyloctyl)cyclopentyl]heptanoic acid |
| SMILES | CCCCC(C)(C)CCC[C@H]1CCC[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C22H42O2/c1-4-5-17-22(2,3)18-11-15-20-14-10-13-19(20)12-8-6-7-9-16-21(23)24/h19-20H,4-18H2,1-3H3,(H,23,24)/t19-,20+/m0/s1 |
| InChIKey | JLVRBNMPNRQLIU-VQTJNVASSA-N |
| XLogP | 7.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|