5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid

C11H19F2NO3 — CID 70065108

IUPAC5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid
SMILESNC1C(CCCCC(=O)O)CCC(F)(F)C1O
InChIInChI=1S/C11H19F2NO3/c12-11(13)6-5-7(9(14)10(11)17)3-1-2-4-8(15)16/h7,9-10,17H,1-6,14H2,(H,15,16)
InChIKeyMZICIKUOFPQNEJ-UHFFFAOYSA-N
MW251.27 g/mol
LogP1.36
Rot. Bonds5

About 5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid

5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid (PubChem CID 70065108) has the molecular formula C11H19F2NO3 and a molecular weight of 251.27 g/mol. Its IUPAC name is 5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid.

Molecular Properties

Compound Name5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid
PubChem CID70065108
Molecular FormulaC11H19F2NO3
Molecular Weight251.27 g/mol
Exact Mass251.13
IUPAC Name5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid
SMILESNC1C(CCCCC(=O)O)CCC(F)(F)C1O
InChIInChI=1S/C11H19F2NO3/c12-11(13)6-5-7(9(14)10(11)17)3-1-2-4-8(15)16/h7,9-10,17H,1-6,14H2,(H,15,16)
InChIKeyMZICIKUOFPQNEJ-UHFFFAOYSA-N
XLogP1.36
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.27
LogP ≤ 51.36
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid?
The IUPAC name of 5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid (CID 70065108) is 5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid.
What is the SMILES notation for 5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid?
The canonical SMILES for 5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid is NC1C(CCCCC(=O)O)CCC(F)(F)C1O.
What is the InChIKey of 5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid?
The InChIKey is MZICIKUOFPQNEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO3/c12-11(13)6-5-7(9(14)10(11)17)3-1-2-4-8(15)16/h7,9-10,17H,1-6,14H2,(H,15,16).
What are the key properties of 5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid?
5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid has a molecular weight of 251.27 g/mol, XLogP of 1.36, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid is sourced from PubChem (CID 70065108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).