C11H19F2NO3 — CID 70065108
5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid (PubChem CID 70065108) has the molecular formula C11H19F2NO3 and a molecular weight of 251.27 g/mol. Its IUPAC name is 5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid.
| Compound Name | 5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid |
|---|---|
| PubChem CID | 70065108 |
| Molecular Formula | C11H19F2NO3 |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 5-(2-amino-4,4-difluoro-3-hydroxycyclohexyl)pentanoic acid |
| SMILES | NC1C(CCCCC(=O)O)CCC(F)(F)C1O |
| InChI | InChI=1S/C11H19F2NO3/c12-11(13)6-5-7(9(14)10(11)17)3-1-2-4-8(15)16/h7,9-10,17H,1-6,14H2,(H,15,16) |
| InChIKey | MZICIKUOFPQNEJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|