C17H36N4O4S — CID 70828633
N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-5-(3,4-diaminothiolan-2-yl)pentanamide (PubChem CID 70828633) has the molecular formula C17H36N4O4S and a molecular weight of 392.57 g/mol. Its IUPAC name is N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-5-(3,4-diaminothiolan-2-yl)pentanamide.
| Compound Name | N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-5-(3,4-diaminothiolan-2-yl)pentanamide |
|---|---|
| PubChem CID | 70828633 |
| Molecular Formula | C17H36N4O4S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-5-(3,4-diaminothiolan-2-yl)pentanamide |
| SMILES | NCCOCCOCCOCCNC(=O)CCCCC1SCC(N)C1N |
| InChI | InChI=1S/C17H36N4O4S/c18-5-7-23-9-11-25-12-10-24-8-6-21-16(22)4-2-1-3-15-17(20)14(19)13-26-15/h14-15,17H,1-13,18-20H2,(H,21,22) |
| InChIKey | ZVRUUCSFYFQCNC-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 134.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|