C11H23N3OS — CID 121263431
5-(3,4-diaminothiolan-2-yl)-N-ethylpentanamide (PubChem CID 121263431) has the molecular formula C11H23N3OS and a molecular weight of 245.39 g/mol. Its IUPAC name is 5-(3,4-diaminothiolan-2-yl)-N-ethylpentanamide.
| Compound Name | 5-(3,4-diaminothiolan-2-yl)-N-ethylpentanamide |
|---|---|
| PubChem CID | 121263431 |
| Molecular Formula | C11H23N3OS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 5-(3,4-diaminothiolan-2-yl)-N-ethylpentanamide |
| SMILES | CCNC(=O)CCCCC1SCC(N)C1N |
| InChI | InChI=1S/C11H23N3OS/c1-2-14-10(15)6-4-3-5-9-11(13)8(12)7-16-9/h8-9,11H,2-7,12-13H2,1H3,(H,14,15) |
| InChIKey | HKXUZLFTGOBVCP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|