C18H33N5O3S — CID 122236782
2-amino-N-ethyl-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanamide (PubChem CID 122236782) has the molecular formula C18H33N5O3S and a molecular weight of 399.56 g/mol. Its IUPAC name is 2-amino-N-ethyl-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanamide.
| Compound Name | 2-amino-N-ethyl-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanamide |
|---|---|
| PubChem CID | 122236782 |
| Molecular Formula | C18H33N5O3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 2-amino-N-ethyl-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanamide |
| SMILES | CCNC(=O)C(N)CCCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C18H33N5O3S/c1-2-20-17(25)12(19)7-5-6-10-21-15(24)9-4-3-8-14-16-13(11-27-14)22-18(26)23-16/h12-14,16H,2-11,19H2,1H3,(H,20,25)(H,21,24)(H2,22,23,26) |
| InChIKey | VKQNZEASMILCKT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|