C20H41N5O5S — CID 89008096
N-[2-[2-[2-[2-[5-(3,4-diaminothiolan-2-yl)pentylamino]ethoxy]ethoxy]ethoxy]ethyl]-2-(methylideneamino)oxyacetamide (PubChem CID 89008096) has the molecular formula C20H41N5O5S and a molecular weight of 463.65 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[5-(3,4-diaminothiolan-2-yl)pentylamino]ethoxy]ethoxy]ethoxy]ethyl]-2-(methylideneamino)oxyacetamide.
| Compound Name | N-[2-[2-[2-[2-[5-(3,4-diaminothiolan-2-yl)pentylamino]ethoxy]ethoxy]ethoxy]ethyl]-2-(methylideneamino)oxyacetamide |
|---|---|
| PubChem CID | 89008096 |
| Molecular Formula | C20H41N5O5S |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-[2-[2-[2-[2-[5-(3,4-diaminothiolan-2-yl)pentylamino]ethoxy]ethoxy]ethoxy]ethyl]-2-(methylideneamino)oxyacetamide |
| SMILES | C=NOCC(=O)NCCOCCOCCOCCNCCCCCC1SCC(N)C1N |
| InChI | InChI=1S/C20H41N5O5S/c1-23-30-15-19(26)25-8-10-28-12-14-29-13-11-27-9-7-24-6-4-2-3-5-18-20(22)17(21)16-31-18/h17-18,20,24H,1-16,21-22H2,(H,25,26) |
| InChIKey | LFQFOSOBNUPKQU-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|