C15H26O5 — CID 15165647
11-[(2R,3R)-3-(hydroxymethyl)-4-oxooxetan-2-yl]undecanoic acid (PubChem CID 15165647) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is 11-[(2R,3R)-3-(hydroxymethyl)-4-oxooxetan-2-yl]undecanoic acid.
| Compound Name | 11-[(2R,3R)-3-(hydroxymethyl)-4-oxooxetan-2-yl]undecanoic acid |
|---|---|
| PubChem CID | 15165647 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 11-[(2R,3R)-3-(hydroxymethyl)-4-oxooxetan-2-yl]undecanoic acid |
| SMILES | O=C(O)CCCCCCCCCC[C@H]1OC(=O)[C@@H]1CO |
| InChI | InChI=1S/C15H26O5/c16-11-12-13(20-15(12)19)9-7-5-3-1-2-4-6-8-10-14(17)18/h12-13,16H,1-11H2,(H,17,18)/t12-,13-/m1/s1 |
| InChIKey | OOTQVYGCLLONGQ-CHWSQXEVSA-N |
| XLogP | 2.51 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|