C17H26O5 — CID 163126121
11-[3-(hydroxymethyl)-4-oxooxetan-2-yl]-3,5-dimethylundeca-2,4-dienoic acid (PubChem CID 163126121) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is 11-[3-(hydroxymethyl)-4-oxooxetan-2-yl]-3,5-dimethylundeca-2,4-dienoic acid.
| Compound Name | 11-[3-(hydroxymethyl)-4-oxooxetan-2-yl]-3,5-dimethylundeca-2,4-dienoic acid |
|---|---|
| PubChem CID | 163126121 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 11-[3-(hydroxymethyl)-4-oxooxetan-2-yl]-3,5-dimethylundeca-2,4-dienoic acid |
| SMILES | CC(=CC(=O)O)C=C(C)CCCCCCC1OC(=O)C1CO |
| InChI | InChI=1S/C17H26O5/c1-12(9-13(2)10-16(19)20)7-5-3-4-6-8-15-14(11-18)17(21)22-15/h9-10,14-15,18H,3-8,11H2,1-2H3,(H,19,20) |
| InChIKey | DJCXVFBEHFTGPG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|