C13H20O5S — CID 176780588
propan-2-yl 5-(2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)pentanoate (PubChem CID 176780588) has the molecular formula C13H20O5S and a molecular weight of 288.36 g/mol. Its IUPAC name is propan-2-yl 5-(2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)pentanoate.
| Compound Name | propan-2-yl 5-(2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)pentanoate |
|---|---|
| PubChem CID | 176780588 |
| Molecular Formula | C13H20O5S |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | propan-2-yl 5-(2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)pentanoate |
| SMILES | CC(C)OC(=O)CCCCC1SCC2OC(=O)OC21 |
| InChI | InChI=1S/C13H20O5S/c1-8(2)16-11(14)6-4-3-5-10-12-9(7-19-10)17-13(15)18-12/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | MIZGEFJIFNFJEC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|