C17H13F5O2 — CID 71505980
3-benzyl-2,2,4,4,4-pentafluoro-3-hydroxy-1-phenylbutan-1-one (PubChem CID 71505980) has the molecular formula C17H13F5O2 and a molecular weight of 344.28 g/mol. Its IUPAC name is 3-benzyl-2,2,4,4,4-pentafluoro-3-hydroxy-1-phenylbutan-1-one.
| Compound Name | 3-benzyl-2,2,4,4,4-pentafluoro-3-hydroxy-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 71505980 |
| Molecular Formula | C17H13F5O2 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3-benzyl-2,2,4,4,4-pentafluoro-3-hydroxy-1-phenylbutan-1-one |
| SMILES | O=C(c1ccccc1)C(F)(F)C(O)(Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H13F5O2/c18-16(19,14(23)13-9-5-2-6-10-13)15(24,17(20,21)22)11-12-7-3-1-4-8-12/h1-10,24H,11H2 |
| InChIKey | NRUUTDVWPIJOOL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |