C10H17F2NO2 — CID 71506325
(1S,2S,3S,6R,8R)-3-ethyl-7,7-difluoro-6-methyl-1,2,3,5,6,8-hexahydropyrrolizine-1,2-diol (PubChem CID 71506325) has the molecular formula C10H17F2NO2 and a molecular weight of 221.25 g/mol. Its IUPAC name is (1S,2S,3S,6R,8R)-3-ethyl-7,7-difluoro-6-methyl-1,2,3,5,6,8-hexahydropyrrolizine-1,2-diol.
| Compound Name | (1S,2S,3S,6R,8R)-3-ethyl-7,7-difluoro-6-methyl-1,2,3,5,6,8-hexahydropyrrolizine-1,2-diol |
|---|---|
| PubChem CID | 71506325 |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (1S,2S,3S,6R,8R)-3-ethyl-7,7-difluoro-6-methyl-1,2,3,5,6,8-hexahydropyrrolizine-1,2-diol |
| SMILES | CC[C@H]1[C@H](O)[C@@H](O)[C@H]2N1C[C@@H](C)C2(F)F |
| InChI | InChI=1S/C10H17F2NO2/c1-3-6-7(14)8(15)9-10(11,12)5(2)4-13(6)9/h5-9,14-15H,3-4H2,1-2H3/t5-,6+,7+,8-,9-/m1/s1 |
| InChIKey | YGZWIWHJGIREOD-QMGXLNLGSA-N |
| XLogP | 0.46 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |