C23H26ClN3O3S — CID 71506797
N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-1-cyclohexyl-N-[(5-nitrothiophen-2-yl)methyl]methanamine (PubChem CID 71506797) has the molecular formula C23H26ClN3O3S and a molecular weight of 460.00 g/mol. Its IUPAC name is N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-1-cyclohexyl-N-[(5-nitrothiophen-2-yl)methyl]methanamine.
| Compound Name | N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-1-cyclohexyl-N-[(5-nitrothiophen-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 71506797 |
| Molecular Formula | C23H26ClN3O3S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-1-cyclohexyl-N-[(5-nitrothiophen-2-yl)methyl]methanamine |
| SMILES | COc1ccc2nc(Cl)c(CN(Cc3ccc([N+](=O)[O-])s3)CC3CCCCC3)cc2c1 |
| InChI | InChI=1S/C23H26ClN3O3S/c1-30-19-7-9-21-17(12-19)11-18(23(24)25-21)14-26(13-16-5-3-2-4-6-16)15-20-8-10-22(31-20)27(28)29/h7-12,16H,2-6,13-15H2,1H3 |
| InChIKey | JCAXURLOQHFVSW-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|