C17H21N3O3S — CID 71510444
(2S)-2-[(2-amino-3-prop-2-enylsulfanylpropanoyl)amino]-3-(1H-indol-5-yl)propanoic acid (PubChem CID 71510444) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is (2S)-2-[(2-amino-3-prop-2-enylsulfanylpropanoyl)amino]-3-(1H-indol-5-yl)propanoic acid.
| Compound Name | (2S)-2-[(2-amino-3-prop-2-enylsulfanylpropanoyl)amino]-3-(1H-indol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 71510444 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (2S)-2-[(2-amino-3-prop-2-enylsulfanylpropanoyl)amino]-3-(1H-indol-5-yl)propanoic acid |
| SMILES | C=CCSCC(N)C(=O)N[C@@H](Cc1ccc2[nH]ccc2c1)C(=O)O |
| InChI | InChI=1S/C17H21N3O3S/c1-2-7-24-10-13(18)16(21)20-15(17(22)23)9-11-3-4-14-12(8-11)5-6-19-14/h2-6,8,13,15,19H,1,7,9-10,18H2,(H,20,21)(H,22,23)/t13?,15-/m0/s1 |
| InChIKey | MEPTUEBPYDBBFK-WUJWULDRSA-N |
| XLogP | 1.53 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|