C27H23F6N5O3S — CID 71510469
2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-1-[4-[4-[5-(2,6-difluoro-3-prop-2-ynoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone (PubChem CID 71510469) has the molecular formula C27H23F6N5O3S and a molecular weight of 611.57 g/mol. Its IUPAC name is 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-1-[4-[4-[5-(2,6-difluoro-3-prop-2-ynoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-1-[4-[4-[5-(2,6-difluoro-3-prop-2-ynoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 71510469 |
| Molecular Formula | C27H23F6N5O3S |
| Molecular Weight | 611.57 g/mol |
| Exact Mass | 611.14 |
| IUPAC Name | 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-1-[4-[4-[5-(2,6-difluoro-3-prop-2-ynoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone |
| SMILES | C#CCOc1ccc(F)c(C2CC(c3csc(C4CCN(C(=O)Cn5nc(C(F)F)cc5C(F)F)CC4)n3)=NO2)c1F |
| InChI | InChI=1S/C27H23F6N5O3S/c1-2-9-40-20-4-3-15(28)23(24(20)29)21-11-16(36-41-21)18-13-42-27(34-18)14-5-7-37(8-6-14)22(39)12-38-19(26(32)33)10-17(35-38)25(30)31/h1,3-4,10,13-14,21,25-26H,5-9,11-12H2 |
| InChIKey | NXVPNHZGYRUBHU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 81.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.57 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|