C25H21F6N5O3S — CID 71509185
4-[3-[2-[1-[2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-1,3-thiazol-4-yl]-4,5-dihydro-1,2-oxazol-5-yl]-3,5-difluorobenzaldehyde (PubChem CID 71509185) has the molecular formula C25H21F6N5O3S and a molecular weight of 585.53 g/mol. Its IUPAC name is 4-[3-[2-[1-[2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-1,3-thiazol-4-yl]-4,5-dihydro-1,2-oxazol-5-yl]-3,5-difluorobenzaldehyde.
| Compound Name | 4-[3-[2-[1-[2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-1,3-thiazol-4-yl]-4,5-dihydro-1,2-oxazol-5-yl]-3,5-difluorobenzaldehyde |
|---|---|
| PubChem CID | 71509185 |
| Molecular Formula | C25H21F6N5O3S |
| Molecular Weight | 585.53 g/mol |
| Exact Mass | 585.13 |
| IUPAC Name | 4-[3-[2-[1-[2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetyl]piperidin-4-yl]-1,3-thiazol-4-yl]-4,5-dihydro-1,2-oxazol-5-yl]-3,5-difluorobenzaldehyde |
| SMILES | O=Cc1cc(F)c(C2CC(c3csc(C4CCN(C(=O)Cn5nc(C(F)F)cc5C(F)F)CC4)n3)=NO2)c(F)c1 |
| InChI | InChI=1S/C25H21F6N5O3S/c26-14-5-12(10-37)6-15(27)22(14)20-8-16(34-39-20)18-11-40-25(32-18)13-1-3-35(4-2-13)21(38)9-36-19(24(30)31)7-17(33-36)23(28)29/h5-7,10-11,13,20,23-24H,1-4,8-9H2 |
| InChIKey | ZQANKVMAFOOSAH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 89.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|