C19H18F2IN3O2S — CID 89195089
1-[4-[4-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]-2-iodoethanone (PubChem CID 89195089) has the molecular formula C19H18F2IN3O2S and a molecular weight of 517.34 g/mol. Its IUPAC name is 1-[4-[4-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]-2-iodoethanone.
| Compound Name | 1-[4-[4-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]-2-iodoethanone |
|---|---|
| PubChem CID | 89195089 |
| Molecular Formula | C19H18F2IN3O2S |
| Molecular Weight | 517.34 g/mol |
| Exact Mass | 517.01 |
| IUPAC Name | 1-[4-[4-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]-2-iodoethanone |
| SMILES | O=C(CI)N1CCC(c2nc(C3=NOC(c4c(F)cccc4F)C3)cs2)CC1 |
| InChI | InChI=1S/C19H18F2IN3O2S/c20-12-2-1-3-13(21)18(12)16-8-14(24-27-16)15-10-28-19(23-15)11-4-6-25(7-5-11)17(26)9-22/h1-3,10-11,16H,4-9H2 |
| InChIKey | UUDAKRSRXOXUII-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|