C24H20Cl4N4O3S — CID 135362890
5-chloro-1-[2-oxo-2-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]pyridin-2-one (PubChem CID 135362890) has the molecular formula C24H20Cl4N4O3S and a molecular weight of 586.33 g/mol. Its IUPAC name is 5-chloro-1-[2-oxo-2-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]pyridin-2-one.
| Compound Name | 5-chloro-1-[2-oxo-2-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 135362890 |
| Molecular Formula | C24H20Cl4N4O3S |
| Molecular Weight | 586.33 g/mol |
| Exact Mass | 584.00 |
| IUPAC Name | 5-chloro-1-[2-oxo-2-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]pyridin-2-one |
| SMILES | O=C(Cn1cc(Cl)ccc1=O)N1CCC(c2nc(C3=NOC(c4c(Cl)cc(Cl)cc4Cl)C3)cs2)CC1 |
| InChI | InChI=1S/C24H20Cl4N4O3S/c25-14-1-2-21(33)32(10-14)11-22(34)31-5-3-13(4-6-31)24-29-19(12-36-24)18-9-20(35-30-18)23-16(27)7-15(26)8-17(23)28/h1-2,7-8,10,12-13,20H,3-6,9,11H2 |
| InChIKey | VLZCQMMVTVHRAM-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.33 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |