C25H19BrCl3F3N4O3S — CID 150956404
2-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]oxy]-1-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone (PubChem CID 150956404) has the molecular formula C25H19BrCl3F3N4O3S and a molecular weight of 698.78 g/mol. Its IUPAC name is 2-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]oxy]-1-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]oxy]-1-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 150956404 |
| Molecular Formula | C25H19BrCl3F3N4O3S |
| Molecular Weight | 698.78 g/mol |
| Exact Mass | 695.94 |
| IUPAC Name | 2-[[5-bromo-3-(trifluoromethyl)-2-pyridinyl]oxy]-1-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone |
| SMILES | O=C(COc1ncc(Br)cc1C(F)(F)F)N1CCC(c2nc(C3=NOC(c4c(Cl)cc(Cl)cc4Cl)C3)cs2)CC1 |
| InChI | InChI=1S/C25H19BrCl3F3N4O3S/c26-13-5-15(25(30,31)32)23(33-9-13)38-10-21(37)36-3-1-12(2-4-36)24-34-19(11-40-24)18-8-20(39-35-18)22-16(28)6-14(27)7-17(22)29/h5-7,9,11-12,20H,1-4,8,10H2 |
| InChIKey | LLECSVIHNATRSZ-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 76.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.78 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |