C25H19Cl3F3N5O5S — CID 159891821
5-nitro-1-[2-oxo-2-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]-3-(trifluoromethyl)pyridin-2-one (PubChem CID 159891821) has the molecular formula C25H19Cl3F3N5O5S and a molecular weight of 664.88 g/mol. Its IUPAC name is 5-nitro-1-[2-oxo-2-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]-3-(trifluoromethyl)pyridin-2-one.
| Compound Name | 5-nitro-1-[2-oxo-2-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]-3-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 159891821 |
| Molecular Formula | C25H19Cl3F3N5O5S |
| Molecular Weight | 664.88 g/mol |
| Exact Mass | 663.01 |
| IUPAC Name | 5-nitro-1-[2-oxo-2-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]-3-(trifluoromethyl)pyridin-2-one |
| SMILES | O=C(Cn1cc([N+](=O)[O-])cc(C(F)(F)F)c1=O)N1CCC(c2nc(C3=NOC(c4c(Cl)cc(Cl)cc4Cl)C3)cs2)CC1 |
| InChI | InChI=1S/C25H19Cl3F3N5O5S/c26-13-5-16(27)22(17(28)6-13)20-8-18(33-41-20)19-11-42-23(32-19)12-1-3-34(4-2-12)21(37)10-35-9-14(36(39)40)7-15(24(35)38)25(29,30)31/h5-7,9,11-12,20H,1-4,8,10H2 |
| InChIKey | NUVSJGVBDUUBIG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 119.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.88 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|