C24H22Cl3N5O3S2 — CID 156739118
2-(3-methylsulfanylpyrazin-2-yl)oxy-1-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone (PubChem CID 156739118) has the molecular formula C24H22Cl3N5O3S2 and a molecular weight of 598.97 g/mol. Its IUPAC name is 2-(3-methylsulfanylpyrazin-2-yl)oxy-1-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-(3-methylsulfanylpyrazin-2-yl)oxy-1-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 156739118 |
| Molecular Formula | C24H22Cl3N5O3S2 |
| Molecular Weight | 598.97 g/mol |
| Exact Mass | 597.02 |
| IUPAC Name | 2-(3-methylsulfanylpyrazin-2-yl)oxy-1-[4-[4-[5-(2,4,6-trichlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone |
| SMILES | CSc1nccnc1OCC(=O)N1CCC(c2nc(C3=NOC(c4c(Cl)cc(Cl)cc4Cl)C3)cs2)CC1 |
| InChI | InChI=1S/C24H22Cl3N5O3S2/c1-36-24-22(28-4-5-29-24)34-11-20(33)32-6-2-13(3-7-32)23-30-18(12-37-23)17-10-19(35-31-17)21-15(26)8-14(25)9-16(21)27/h4-5,8-9,12-13,19H,2-3,6-7,10-11H2,1H3 |
| InChIKey | QBOOGRDSXKCWMS-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 89.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.97 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |