C24H23FN4O3 — CID 71511057
N-[2-fluoro-5-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 71511057) has the molecular formula C24H23FN4O3 and a molecular weight of 434.47 g/mol. Its IUPAC name is N-[2-fluoro-5-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[2-fluoro-5-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71511057 |
| Molecular Formula | C24H23FN4O3 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[2-fluoro-5-[[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H]1c2ccccc2C[C@@H]1O)c1ccc(F)c(NC(=O)c2cnc3n2CCCC3)c1 |
| InChI | InChI=1S/C24H23FN4O3/c25-17-9-8-15(23(31)28-22-16-6-2-1-5-14(16)12-20(22)30)11-18(17)27-24(32)19-13-26-21-7-3-4-10-29(19)21/h1-2,5-6,8-9,11,13,20,22,30H,3-4,7,10,12H2,(H,27,32)(H,28,31)/t20-,22+/m0/s1 |
| InChIKey | YCICTAQSZZWJGZ-RBBKRZOGSA-N |
| XLogP | 3.00 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |