C8H13N3O6S — CID 71511994
(2R,3R,4S,5S)-2-[4-(hydroxymethyl)triazol-1-yl]-1,1-dioxothiane-3,4,5-triol (PubChem CID 71511994) has the molecular formula C8H13N3O6S and a molecular weight of 279.27 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[4-(hydroxymethyl)triazol-1-yl]-1,1-dioxothiane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S)-2-[4-(hydroxymethyl)triazol-1-yl]-1,1-dioxothiane-3,4,5-triol |
|---|---|
| PubChem CID | 71511994 |
| Molecular Formula | C8H13N3O6S |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | (2R,3R,4S,5S)-2-[4-(hydroxymethyl)triazol-1-yl]-1,1-dioxothiane-3,4,5-triol |
| SMILES | O=S1(=O)C[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1n1cc(CO)nn1 |
| InChI | InChI=1S/C8H13N3O6S/c12-2-4-1-11(10-9-4)8-7(15)6(14)5(13)3-18(8,16)17/h1,5-8,12-15H,2-3H2/t5-,6+,7-,8-/m1/s1 |
| InChIKey | DMHMLFGZMIGKPO-ULAWRXDQSA-N |
| XLogP | -3.22 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |