About N'-[N'-[(4-fluorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide
N'-[N'-[(4-fluorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide (PubChem CID 71513426) has the molecular formula C14H20FN5
and a molecular weight of 277.35 g/mol. Its IUPAC name is N'-[N'-[(4-fluorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide.
Molecular Properties
| Compound Name | N'-[N'-[(4-fluorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide |
| PubChem CID | 71513426 |
| Molecular Formula | C14H20FN5 |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N'-[N'-[(4-fluorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide |
| SMILES | NC(=N\Cc1ccc(F)cc1)/N=C(\N)N1CCCCC1 |
| InChI | InChI=1S/C14H20FN5/c15-12-6-4-11(5-7-12)10-18-13(16)19-14(17)20-8-2-1-3-9-20/h4-7H,1-3,8-10H2,(H4,16,17,18,19) |
| InChIKey | STMQXRJUPSDJKN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[N'-[(4-fluorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[N'-[(4-fluorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide?
The IUPAC name of N'-[N'-[(4-fluorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide (CID 71513426) is N'-[N'-[(4-fluorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide.
What is the SMILES notation for N'-[N'-[(4-fluorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide?
The canonical SMILES for N'-[N'-[(4-fluorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide is NC(=N\Cc1ccc(F)cc1)/N=C(\N)N1CCCCC1.
What is the InChIKey of N'-[N'-[(4-fluorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide?
The InChIKey is STMQXRJUPSDJKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FN5/c15-12-6-4-11(5-7-12)10-18-13(16)19-14(17)20-8-2-1-3-9-20/h4-7H,1-3,8-10H2,(H4,16,17,18,19).
What are the key properties of N'-[N'-[(4-fluorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide?
N'-[N'-[(4-fluorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide has a molecular weight of 277.35 g/mol, XLogP of 1.44, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[N'-[(4-fluorophenyl)methyl]carbamimidoyl]piperidine-1-carboximidamide is sourced from PubChem (CID 71513426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).