C25H26FN7OS — CID 71513649
4-[2-amino-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]-N-[4-(dimethylamino)phenyl]piperazine-1-carboxamide (PubChem CID 71513649) has the molecular formula C25H26FN7OS and a molecular weight of 491.60 g/mol. Its IUPAC name is 4-[2-amino-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]-N-[4-(dimethylamino)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[2-amino-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]-N-[4-(dimethylamino)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 71513649 |
| Molecular Formula | C25H26FN7OS |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 4-[2-amino-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]-N-[4-(dimethylamino)phenyl]piperazine-1-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)N2CCN(c3nc(N)nc4scc(-c5ccc(F)cc5)c34)CC2)cc1 |
| InChI | InChI=1S/C25H26FN7OS/c1-31(2)19-9-7-18(8-10-19)28-25(34)33-13-11-32(12-14-33)22-21-20(16-3-5-17(26)6-4-16)15-35-23(21)30-24(27)29-22/h3-10,15H,11-14H2,1-2H3,(H,28,34)(H2,27,29,30) |
| InChIKey | HPDODXNAAMCVFD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|