C23H31N7OS — CID 71513876
4-[2-amino-5-(2-methylpropyl)thieno[2,3-d]pyrimidin-4-yl]-N-[4-(dimethylamino)phenyl]piperazine-1-carboxamide (PubChem CID 71513876) has the molecular formula C23H31N7OS and a molecular weight of 453.62 g/mol. Its IUPAC name is 4-[2-amino-5-(2-methylpropyl)thieno[2,3-d]pyrimidin-4-yl]-N-[4-(dimethylamino)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[2-amino-5-(2-methylpropyl)thieno[2,3-d]pyrimidin-4-yl]-N-[4-(dimethylamino)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 71513876 |
| Molecular Formula | C23H31N7OS |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 4-[2-amino-5-(2-methylpropyl)thieno[2,3-d]pyrimidin-4-yl]-N-[4-(dimethylamino)phenyl]piperazine-1-carboxamide |
| SMILES | CC(C)Cc1csc2nc(N)nc(N3CCN(C(=O)Nc4ccc(N(C)C)cc4)CC3)c12 |
| InChI | InChI=1S/C23H31N7OS/c1-15(2)13-16-14-32-21-19(16)20(26-22(24)27-21)29-9-11-30(12-10-29)23(31)25-17-5-7-18(8-6-17)28(3)4/h5-8,14-15H,9-13H2,1-4H3,(H,25,31)(H2,24,26,27) |
| InChIKey | PFWBBIFCDDHVNT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|