C24H19ClN4O3 — CID 71515235
N-[(E)-(4-chlorophenyl)methylideneamino]-2-(2,4-dioxo-5,5-diphenylimidazolidin-1-yl)acetamide (PubChem CID 71515235) has the molecular formula C24H19ClN4O3 and a molecular weight of 446.89 g/mol. Its IUPAC name is N-[(E)-(4-chlorophenyl)methylideneamino]-2-(2,4-dioxo-5,5-diphenylimidazolidin-1-yl)acetamide.
| Compound Name | N-[(E)-(4-chlorophenyl)methylideneamino]-2-(2,4-dioxo-5,5-diphenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 71515235 |
| Molecular Formula | C24H19ClN4O3 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-[(E)-(4-chlorophenyl)methylideneamino]-2-(2,4-dioxo-5,5-diphenylimidazolidin-1-yl)acetamide |
| SMILES | O=C(CN1C(=O)NC(=O)C1(c1ccccc1)c1ccccc1)N/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19ClN4O3/c25-20-13-11-17(12-14-20)15-26-28-21(30)16-29-23(32)27-22(31)24(29,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-15H,16H2,(H,28,30)(H,27,31,32)/b26-15+ |
| InChIKey | GRFUPBBPDKJGBF-CVKSISIWSA-N |
| XLogP | 3.29 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|