C24H22ClNO3 — CID 71516313
ethyl 2-benzyl-3-(4-chloroanilino)-3-oxo-2-phenylpropanoate (PubChem CID 71516313) has the molecular formula C24H22ClNO3 and a molecular weight of 407.90 g/mol. Its IUPAC name is ethyl 2-benzyl-3-(4-chloroanilino)-3-oxo-2-phenylpropanoate.
| Compound Name | ethyl 2-benzyl-3-(4-chloroanilino)-3-oxo-2-phenylpropanoate |
|---|---|
| PubChem CID | 71516313 |
| Molecular Formula | C24H22ClNO3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | ethyl 2-benzyl-3-(4-chloroanilino)-3-oxo-2-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)(C(=O)Nc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H22ClNO3/c1-2-29-23(28)24(19-11-7-4-8-12-19,17-18-9-5-3-6-10-18)22(27)26-21-15-13-20(25)14-16-21/h3-16H,2,17H2,1H3,(H,26,27) |
| InChIKey | KZMYDCRIVZLGEA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|