C13H26O2Si — CID 71516996
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylcyclopentan-1-one (PubChem CID 71516996) has the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylcyclopentan-1-one.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylcyclopentan-1-one |
|---|---|
| PubChem CID | 71516996 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylcyclopentan-1-one |
| SMILES | CC1(C)C(=O)CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O2Si/c1-12(2,3)16(6,7)15-11-9-8-10(14)13(11,4)5/h11H,8-9H2,1-7H3/t11-/m0/s1 |
| InChIKey | WZWMLPSPRRUCLP-NSHDSACASA-N |
| XLogP | 3.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|