C34H49NO2 — CID 71517656
(8S,9S,10R,13R,14S,17R)-3-(4-methoxyphenyl)imino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 71517656) has the molecular formula C34H49NO2 and a molecular weight of 503.77 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17R)-3-(4-methoxyphenyl)imino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (8S,9S,10R,13R,14S,17R)-3-(4-methoxyphenyl)imino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 71517656 |
| Molecular Formula | C34H49NO2 |
| Molecular Weight | 503.77 g/mol |
| Exact Mass | 503.38 |
| IUPAC Name | (8S,9S,10R,13R,14S,17R)-3-(4-methoxyphenyl)imino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | COc1ccc(/N=C2/C=C3C(=O)C[C@H]4[C@@H]5CC[C@H]([C@H](C)CCCC(C)C)[C@@]5(C)CC[C@@H]4[C@@]3(C)CC2)cc1 |
| InChI | InChI=1S/C34H49NO2/c1-22(2)8-7-9-23(3)28-14-15-29-27-21-32(36)31-20-25(35-24-10-12-26(37-6)13-11-24)16-18-34(31,5)30(27)17-19-33(28,29)4/h10-13,20,22-23,27-30H,7-9,14-19,21H2,1-6H3/b35-25+/t23-,27+,28-,29+,30+,33-,34-/m1/s1 |
| InChIKey | GJKQFMQHNLLDEY-DZEPJLTRSA-N |
| XLogP | 8.99 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.77 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|