C25H22N4O3S — CID 71517705
1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-(7-thiophen-2-yl-1H-pyrrolo[3,2-b]pyridin-3-yl)ethane-1,2-dione (PubChem CID 71517705) has the molecular formula C25H22N4O3S and a molecular weight of 458.54 g/mol. Its IUPAC name is 1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-(7-thiophen-2-yl-1H-pyrrolo[3,2-b]pyridin-3-yl)ethane-1,2-dione.
| Compound Name | 1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-(7-thiophen-2-yl-1H-pyrrolo[3,2-b]pyridin-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 71517705 |
| Molecular Formula | C25H22N4O3S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-(7-thiophen-2-yl-1H-pyrrolo[3,2-b]pyridin-3-yl)ethane-1,2-dione |
| SMILES | C[C@@H]1CN(C(=O)C(=O)c2c[nH]c3c(-c4cccs4)ccnc23)CCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H22N4O3S/c1-16-15-28(11-12-29(16)24(31)17-6-3-2-4-7-17)25(32)23(30)19-14-27-21-18(9-10-26-22(19)21)20-8-5-13-33-20/h2-10,13-14,16,27H,11-12,15H2,1H3/t16-/m1/s1 |
| InChIKey | YBIJFYXNMJWGOX-MRXNPFEDSA-N |
| XLogP | 3.85 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|