C16H22N8O — CID 71517861
(2R)-2-[[9-propan-2-yl-6-(pyrimidin-2-ylamino)purin-2-yl]amino]butan-1-ol (PubChem CID 71517861) has the molecular formula C16H22N8O and a molecular weight of 342.41 g/mol. Its IUPAC name is (2R)-2-[[9-propan-2-yl-6-(pyrimidin-2-ylamino)purin-2-yl]amino]butan-1-ol.
| Compound Name | (2R)-2-[[9-propan-2-yl-6-(pyrimidin-2-ylamino)purin-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 71517861 |
| Molecular Formula | C16H22N8O |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (2R)-2-[[9-propan-2-yl-6-(pyrimidin-2-ylamino)purin-2-yl]amino]butan-1-ol |
| SMILES | CC[C@H](CO)Nc1nc(Nc2ncccn2)c2ncn(C(C)C)c2n1 |
| InChI | InChI=1S/C16H22N8O/c1-4-11(8-25)20-16-22-13(21-15-17-6-5-7-18-15)12-14(23-16)24(9-19-12)10(2)3/h5-7,9-11,25H,4,8H2,1-3H3,(H2,17,18,20,21,22,23)/t11-/m1/s1 |
| InChIKey | CLTIRFBQVYXMKS-LLVKDONJSA-N |
| XLogP | 2.12 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |