C23H31NO6Si — CID 71518135
(2S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxycarbonyl-2,3,8,8a-tetrahydrooxepino[4,3-b]pyrrole-2-carboxylic acid (PubChem CID 71518135) has the molecular formula C23H31NO6Si and a molecular weight of 445.59 g/mol. Its IUPAC name is (2S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxycarbonyl-2,3,8,8a-tetrahydrooxepino[4,3-b]pyrrole-2-carboxylic acid.
| Compound Name | (2S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxycarbonyl-2,3,8,8a-tetrahydrooxepino[4,3-b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 71518135 |
| Molecular Formula | C23H31NO6Si |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (2S,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxycarbonyl-2,3,8,8a-tetrahydrooxepino[4,3-b]pyrrole-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=COC=C2C[C@@H](C(=O)O)N(C(=O)OCc3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C23H31NO6Si/c1-23(2,3)31(4,5)30-19-11-12-28-15-17-13-18(21(25)26)24(20(17)19)22(27)29-14-16-9-7-6-8-10-16/h6-12,15,18-20H,13-14H2,1-5H3,(H,25,26)/t18-,19+,20-/m0/s1 |
| InChIKey | HEVKFMOIAZWTOI-ZCNNSNEGSA-N |
| XLogP | 4.67 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|