C17H24N8O — CID 71518375
(2R)-3-methyl-2-[[9-propan-2-yl-6-(pyridazin-4-ylamino)purin-2-yl]amino]butan-1-ol (PubChem CID 71518375) has the molecular formula C17H24N8O and a molecular weight of 356.43 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[9-propan-2-yl-6-(pyridazin-4-ylamino)purin-2-yl]amino]butan-1-ol.
| Compound Name | (2R)-3-methyl-2-[[9-propan-2-yl-6-(pyridazin-4-ylamino)purin-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 71518375 |
| Molecular Formula | C17H24N8O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (2R)-3-methyl-2-[[9-propan-2-yl-6-(pyridazin-4-ylamino)purin-2-yl]amino]butan-1-ol |
| SMILES | CC(C)[C@H](CO)Nc1nc(Nc2ccnnc2)c2ncn(C(C)C)c2n1 |
| InChI | InChI=1S/C17H24N8O/c1-10(2)13(8-26)22-17-23-15(21-12-5-6-19-20-7-12)14-16(24-17)25(9-18-14)11(3)4/h5-7,9-11,13,26H,8H2,1-4H3,(H2,19,21,22,23,24)/t13-/m0/s1 |
| InChIKey | HFEVNTGRPXCJIM-ZDUSSCGKSA-N |
| XLogP | 2.37 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |