C24H32F3N3O — CID 71518407
[(2R,3aR,6aR)-2-(cyclohexylamino)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone (PubChem CID 71518407) has the molecular formula C24H32F3N3O and a molecular weight of 435.53 g/mol. Its IUPAC name is [(2R,3aR,6aR)-2-(cyclohexylamino)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone.
| Compound Name | [(2R,3aR,6aR)-2-(cyclohexylamino)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
|---|---|
| PubChem CID | 71518407 |
| Molecular Formula | C24H32F3N3O |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | [(2R,3aR,6aR)-2-(cyclohexylamino)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
| SMILES | O=C(N1CCc2ncc(C(F)(F)F)cc2C1)[C@@]12CCC[C@@H]1C[C@@H](NC1CCCCC1)C2 |
| InChI | InChI=1S/C24H32F3N3O/c25-24(26,27)18-11-16-15-30(10-8-21(16)28-14-18)22(31)23-9-4-5-17(23)12-20(13-23)29-19-6-2-1-3-7-19/h11,14,17,19-20,29H,1-10,12-13,15H2/t17-,20-,23-/m1/s1 |
| InChIKey | HAVFEUQOBMGBRS-HCLVMJGWSA-N |
| XLogP | 4.86 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |