C17H31NO3 — CID 71519133
(2S,3S,4S)-3,4-bis[(2-methylpropan-2-yl)oxy]-1-oxido-2-pent-4-enyl-3,4-dihydro-2H-pyrrol-1-ium (PubChem CID 71519133) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is (2S,3S,4S)-3,4-bis[(2-methylpropan-2-yl)oxy]-1-oxido-2-pent-4-enyl-3,4-dihydro-2H-pyrrol-1-ium.
| Compound Name | (2S,3S,4S)-3,4-bis[(2-methylpropan-2-yl)oxy]-1-oxido-2-pent-4-enyl-3,4-dihydro-2H-pyrrol-1-ium |
|---|---|
| PubChem CID | 71519133 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | (2S,3S,4S)-3,4-bis[(2-methylpropan-2-yl)oxy]-1-oxido-2-pent-4-enyl-3,4-dihydro-2H-pyrrol-1-ium |
| SMILES | C=CCCC[C@H]1[C@H](OC(C)(C)C)[C@@H](OC(C)(C)C)C=[N+]1[O-] |
| InChI | InChI=1S/C17H31NO3/c1-8-9-10-11-13-15(21-17(5,6)7)14(12-18(13)19)20-16(2,3)4/h8,12-15H,1,9-11H2,2-7H3/t13-,14-,15-/m0/s1 |
| InChIKey | DXSGVJMYBQQKCR-KKUMJFAQSA-N |
| XLogP | 3.67 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|