C20H30O2 — CID 71519907
(E)-3-methyl-4-[(7R)-1,1,6,7-tetramethyl-2,3,4,7,8,9-hexahydrobenzo[7]annulen-5-yl]but-2-enoic acid (PubChem CID 71519907) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (E)-3-methyl-4-[(7R)-1,1,6,7-tetramethyl-2,3,4,7,8,9-hexahydrobenzo[7]annulen-5-yl]but-2-enoic acid.
| Compound Name | (E)-3-methyl-4-[(7R)-1,1,6,7-tetramethyl-2,3,4,7,8,9-hexahydrobenzo[7]annulen-5-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 71519907 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (E)-3-methyl-4-[(7R)-1,1,6,7-tetramethyl-2,3,4,7,8,9-hexahydrobenzo[7]annulen-5-yl]but-2-enoic acid |
| SMILES | CC1=C(C/C(C)=C/C(=O)O)C2=C(CC[C@H]1C)C(C)(C)CCC2 |
| InChI | InChI=1S/C20H30O2/c1-13(12-19(21)22)11-17-15(3)14(2)8-9-18-16(17)7-6-10-20(18,4)5/h12,14H,6-11H2,1-5H3,(H,21,22)/b13-12+/t14-/m1/s1 |
| InChIKey | FTPHUZUSRWWTEH-XTZCOPOCSA-N |
| XLogP | 5.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|