C21H23N3OS — CID 71520821
3-cyclohexylsulfanyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazole (PubChem CID 71520821) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is 3-cyclohexylsulfanyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazole.
| Compound Name | 3-cyclohexylsulfanyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 71520821 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 3-cyclohexylsulfanyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazole |
| SMILES | c1ccc(OCc2nnc(SC3CCCCC3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23N3OS/c1-4-10-17(11-5-1)24-20(16-25-18-12-6-2-7-13-18)22-23-21(24)26-19-14-8-3-9-15-19/h1-2,4-7,10-13,19H,3,8-9,14-16H2 |
| InChIKey | ZUXXVMABLHPUJO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |