C22H21N7O — CID 71520868
4-[4-(1H-indazol-7-yl)-7-pyridin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-yl]morpholine (PubChem CID 71520868) has the molecular formula C22H21N7O and a molecular weight of 399.40 g/mol. Its IUPAC name is 4-[4-(1H-indazol-7-yl)-7-pyridin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-yl]morpholine.
| Compound Name | 4-[4-(1H-indazol-7-yl)-7-pyridin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 71520868 |
| Molecular Formula | C22H21N7O |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 4-[4-(1H-indazol-7-yl)-7-pyridin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-2-yl]morpholine |
| SMILES | C1CN(C2=NC(=NC(=C21)C3=CC=CC4=C3NN=C4)N5CCOCC5)C6=CC=NC=C6 |
| InChI | InChI=1S/C22H21N7O/c1-2-15-14-24-27-19(15)17(3-1)20-18-6-9-29(16-4-7-23-8-5-16)21(18)26-22(25-20)28-10-12-30-13-11-28/h1-5,7-8,14H,6,9-13H2,(H,24,27) |
| InChIKey | FZJDGWASYASXGQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 83.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | 582 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|