C19H30NO2+ — CID 71522404
cyclohexyl-[2-(2,6-dimethylbenzoyl)oxyethyl]-dimethylazanium (PubChem CID 71522404) has the molecular formula C19H30NO2+ and a molecular weight of 304.45 g/mol. Its IUPAC name is cyclohexyl-[2-(2,6-dimethylbenzoyl)oxyethyl]-dimethylazanium.
| Compound Name | cyclohexyl-[2-(2,6-dimethylbenzoyl)oxyethyl]-dimethylazanium |
|---|---|
| PubChem CID | 71522404 |
| Molecular Formula | C19H30NO2+ |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | cyclohexyl-[2-(2,6-dimethylbenzoyl)oxyethyl]-dimethylazanium |
| SMILES | Cc1cccc(C)c1C(=O)OCC[N+](C)(C)C1CCCCC1 |
| InChI | InChI=1S/C19H30NO2/c1-15-9-8-10-16(2)18(15)19(21)22-14-13-20(3,4)17-11-6-5-7-12-17/h8-10,17H,5-7,11-14H2,1-4H3/q+1 |
| InChIKey | AFNKFZTVZPUZFW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|